ChemNet > CAS > 605-62-9 4-Nitro-1-Naphthol
605-62-9 4-Nitro-1-Naphthol
| نام محصول |
4-Nitro-1-Naphthol |
| مترادف |
4-nitronaphthalen-1-ol |
| میدان مغناطیسی |
C10H7NO3 |
| وزن مولکولی |
189.1675 |
| InChI |
InChI=1/C10H7NO3/c12-10-6-5-9(11(13)14)7-3-1-2-4-8(7)10/h1-6,12H |
| شماره سیایاس |
605-62-9 |
| ساختار مولکولی |
|
| تراکم |
1.413g/cm3 |
| نقطه غلیان |
398.8°C at 760 mmHg |
| ضریب شکست |
1.714 |
| نقطه اشتعال |
179.8°C |
| خطر نمادها |
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| توضیحات ایمنی |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
