ChemNet > CAS > 615-94-1 2,5-Dihydroxy-1,4-benzoquinone
615-94-1 2,5-Dihydroxy-1,4-benzoquinone
| نام محصول |
2,5-Dihydroxy-1,4-benzoquinone |
| مترادف |
2,5-Dihydroxybenzoquinone; 2,5-dihydroxycyclohexa-2,5-diene-1,4-dione |
| میدان مغناطیسی |
C6H4O4 |
| وزن مولکولی |
140.0936 |
| InChI |
InChI=1/C6H4O4/c7-3-1-4(8)6(10)2-5(3)9/h1-2,7,10H |
| شماره سیایاس |
615-94-1 |
| تعداد کمیسیون اروپایی |
210-454-3 |
| ساختار مولکولی |
|
| تراکم |
1.843g/cm3 |
| نقطه ذوب |
220℃ |
| نقطه غلیان |
322.3°C at 760 mmHg |
| ضریب شکست |
1.729 |
| نقطه اشتعال |
162.9°C |
| خطر نمادها |
 Xn:Harmful;
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|
