ChemNet > CAS > 615-94-1 2,5-Dihydroxy-1,4-benzoquinone
615-94-1 2,5-Dihydroxy-1,4-benzoquinone
نام محصول |
2,5-Dihydroxy-1,4-benzoquinone |
مترادف |
2,5-Dihydroxybenzoquinone; 2,5-dihydroxycyclohexa-2,5-diene-1,4-dione |
میدان مغناطیسی |
C6H4O4 |
وزن مولکولی |
140.0936 |
InChI |
InChI=1/C6H4O4/c7-3-1-4(8)6(10)2-5(3)9/h1-2,7,10H |
شماره سیایاس |
615-94-1 |
تعداد کمیسیون اروپایی |
210-454-3 |
ساختار مولکولی |
|
تراکم |
1.843g/cm3 |
نقطه ذوب |
220℃ |
نقطه غلیان |
322.3°C at 760 mmHg |
ضریب شکست |
1.729 |
نقطه اشتعال |
162.9°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|