ChemNet > CAS > 632-22-4 1,1,3,3-Tetramethylurea
632-22-4 1,1,3,3-Tetramethylurea
| نام محصول |
1,1,3,3-Tetramethylurea |
| مترادف |
Tetramethylurea |
| میدان مغناطیسی |
C5H12N2O |
| وزن مولکولی |
116.16 |
| InChI |
InChI=1/C5H12N2O/c1-6(2)5(8)7(3)4/h1-4H3 |
| شماره سیایاس |
632-22-4 |
| تعداد کمیسیون اروپایی |
211-173-9 |
| ساختار مولکولی |
|
| تراکم |
0.9879 |
| نقطه ذوب |
-1℃ |
| نقطه غلیان |
174-178℃ |
| ضریب شکست |
1.4496-1.4516 |
| نقطه اشتعال |
65℃ |
| حلالیت آب |
miscible |
| خطر نمادها |
 Xn:Harmful;
|
| کدهای خطر |
R22:;
|
| توضیحات ایمنی |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|
