ChemNet > CAS > 64399-28-6 1-(4-Chlorophenyl)-1-cyclohexanecarbonitrile
64399-28-6 1-(4-Chlorophenyl)-1-cyclohexanecarbonitrile
نام محصول |
1-(4-Chlorophenyl)-1-cyclohexanecarbonitrile |
مترادف |
1-(4-Chlorophenyl)cyclohexanecarbonitrile |
میدان مغناطیسی |
C13H14ClN |
وزن مولکولی |
219.71 |
InChI |
InChI=1/C13H14ClN/c14-12-6-4-11(5-7-12)13(10-15)8-2-1-3-9-13/h4-7H,1-3,8-9H2 |
شماره سیایاس |
64399-28-6 |
تعداد کمیسیون اروپایی |
264-872-6 |
ساختار مولکولی |
|
تراکم |
1.14g/cm3 |
نقطه ذوب |
88-92℃ |
نقطه غلیان |
350.5°C at 760 mmHg |
ضریب شکست |
1.559 |
نقطه اشتعال |
143.5°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|