ChemNet > CAS > 6575-13-9 2,6-Dimethylbenzonitrile
6575-13-9 2,6-Dimethylbenzonitrile
| نام محصول |
2,6-Dimethylbenzonitrile |
| مترادف |
2,6-Dimethylbenzoniitrile |
| میدان مغناطیسی |
C9H9N |
| وزن مولکولی |
131.1745 |
| InChI |
InChI=1/C9H9N/c1-7-4-3-5-8(2)9(7)6-10/h3-5H,1-2H3 |
| شماره سیایاس |
6575-13-9 |
| تعداد کمیسیون اروپایی |
229-503-5 |
| ساختار مولکولی |
|
| تراکم |
0.99g/cm3 |
| نقطه ذوب |
87-89℃ |
| نقطه غلیان |
228.7°C at 760 mmHg |
| ضریب شکست |
1.525 |
| نقطه اشتعال |
91.9°C |
| خطر نمادها |
 Xn:Harmful;
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|
