ChemNet > CAS > 65858-50-6 5-(bromomethyl)-2,1,3-benzothiadiazole
65858-50-6 5-(bromomethyl)-2,1,3-benzothiadiazole
نام محصول |
5-(bromomethyl)-2,1,3-benzothiadiazole |
میدان مغناطیسی |
C7H5BrN2S |
وزن مولکولی |
229.097 |
InChI |
InChI=1/C7H5BrN2S/c8-4-5-1-2-6-7(3-5)10-11-9-6/h1-3H,4H2 |
شماره سیایاس |
65858-50-6 |
ساختار مولکولی |
|
تراکم |
1.776g/cm3 |
نقطه ذوب |
87℃ |
نقطه غلیان |
299.3°C at 760 mmHg |
ضریب شکست |
1.726 |
نقطه اشتعال |
134.8°C |
خطر نمادها |
C:Corrosive;
|
کدهای خطر |
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|