ChemNet > CAS > 69038-81-9 2-Ethoxycinnamic acid
69038-81-9 2-Ethoxycinnamic acid
| نام محصول |
2-Ethoxycinnamic acid |
| مترادف |
(2E)-3-(2-ethoxyphenyl)prop-2-enoic acid |
| میدان مغناطیسی |
C11H12O3 |
| وزن مولکولی |
192.2112 |
| InChI |
InChI=1/C11H12O3/c1-2-14-10-6-4-3-5-9(10)7-8-11(12)13/h3-8H,2H2,1H3,(H,12,13)/b8-7+ |
| شماره سیایاس |
69038-81-9 |
| ساختار مولکولی |
|
| تراکم |
1.161g/cm3 |
| نقطه ذوب |
134-138℃ |
| نقطه غلیان |
337.2°C at 760 mmHg |
| ضریب شکست |
1.579 |
| نقطه اشتعال |
131.7°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
