ChemNet > CAS > 6909-93-9 2,5-Diamino-4-picoline
6909-93-9 2,5-Diamino-4-picoline
نام محصول |
2,5-Diamino-4-picoline |
مترادف |
4-methylpyridine-2,5-diamine; 2,5-diamino-4-methylpyridinium |
میدان مغناطیسی |
C6H10N3 |
وزن مولکولی |
124.1632 |
InChI |
InChI=1/C6H9N3/c1-4-2-6(8)9-3-5(4)7/h2-3H,7H2,1H3,(H2,8,9)/p+1 |
شماره سیایاس |
6909-93-9 |
ساختار مولکولی |
|
نقطه غلیان |
333°C at 760 mmHg |
نقطه اشتعال |
181.6°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|