ChemNet > CAS > 698-67-9 4-Bromobenzamide
698-67-9 4-Bromobenzamide
نام محصول |
4-Bromobenzamide |
مترادف |
4-Bromobenzamide,97%; p-bromo-benzamid; p-bromobenzoicacidamide; P-BROMOBENZAMIDE |
میدان مغناطیسی |
C7H6BrNO |
وزن مولکولی |
200.0326 |
InChI |
InChI=1/C7H6BrNO/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,(H2,9,10) |
شماره سیایاس |
698-67-9 |
تعداد کمیسیون اروپایی |
211-817-9 |
ساختار مولکولی |
|
تراکم |
1.609g/cm3 |
نقطه ذوب |
189-194℃ |
نقطه غلیان |
309.9°C at 760 mmHg |
ضریب شکست |
1.605 |
نقطه اشتعال |
141.2°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|