ChemNet > CAS > 7149-69-1 1,3-dichloro-2-methyl-5-nitrobenzene
7149-69-1 1,3-dichloro-2-methyl-5-nitrobenzene
نام محصول |
1,3-dichloro-2-methyl-5-nitrobenzene |
مترادف |
2,6-Dichloro-4-nitrotoluene |
میدان مغناطیسی |
C7H5Cl2NO2 |
وزن مولکولی |
206.0261 |
InChI |
InChI=1/C7H5Cl2NO2/c1-4-6(8)2-5(10(11)12)3-7(4)9/h2-3H,1H3 |
شماره سیایاس |
7149-69-1 |
ساختار مولکولی |
|
تراکم |
1.456g/cm3 |
نقطه ذوب |
62℃ |
نقطه غلیان |
279.6°C at 760 mmHg |
ضریب شکست |
1.585 |
نقطه اشتعال |
122.9°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|