ChemNet > CAS > 72-55-9 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene
72-55-9 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene
نام محصول |
2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene |
مترادف |
p,p-DDE |
میدان مغناطیسی |
C14H8Cl4 |
وزن مولکولی |
318.02 |
InChI |
InChI=1/C14H8Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8H |
شماره سیایاس |
72-55-9 |
تعداد کمیسیون اروپایی |
200-784-6 |
ساختار مولکولی |
|
نقطه ذوب |
87-90℃ |
حلالیت آب |
0.00000013 g/100 mL |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R22:Harmful if swallowed.;
R33:Danger of cummulative effects.;
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|