ChemNet > CAS > 74246-64-3 1,3-Thiazolin-4-one-2-acetonitrile
74246-64-3 1,3-Thiazolin-4-one-2-acetonitrile
| نام محصول |
1,3-Thiazolin-4-one-2-acetonitrile |
| مترادف |
2-(4-Oxo-4,5-dihydro-1,3-thiazol-2-yl)acetonitrile; (4-oxo-4,5-dihydro-1,3-thiazol-2-yl)acetonitrile |
| میدان مغناطیسی |
C5H4N2OS |
| وزن مولکولی |
140.1631 |
| InChI |
InChI=1/C5H4N2OS/c6-2-1-5-7-4(8)3-9-5/h1,3H2 |
| شماره سیایاس |
74246-64-3 |
| ساختار مولکولی |
|
| تراکم |
1.43g/cm3 |
| نقطه ذوب |
185℃ |
| نقطه غلیان |
300.6°C at 760 mmHg |
| ضریب شکست |
1.675 |
| نقطه اشتعال |
135.6°C |
| خطر نمادها |
 Xn:Harmful;
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|
