ChemNet > CAS > 7650-84-2 diphenylpropylphosphine
7650-84-2 diphenylpropylphosphine
نام محصول |
diphenylpropylphosphine |
مترادف |
Diphenyl-n-propylphosphine; n-Propyldiphenylphosphine; Diphenyln-propylphosphine; diphenyl(propyl)phosphane |
میدان مغناطیسی |
C15H17P |
وزن مولکولی |
228.2692 |
InChI |
InChI=1/C15H17P/c1-2-13-16(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,2,13H2,1H3 |
شماره سیایاس |
7650-84-2 |
تعداد کمیسیون اروپایی |
231-607-0 |
ساختار مولکولی |
|
نقطه غلیان |
304.1°C at 760 mmHg |
نقطه اشتعال |
150.5°C |
خطر نمادها |
|
کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|