ChemNet > CAS > 76989-89-4 Cyanourea, sodium salt
76989-89-4 Cyanourea, sodium salt
| نام محصول |
Cyanourea, sodium salt |
| مترادف |
Cyanourea sodium salt; Cyanoisourea sodium salt; 1-cyanourea; sodium N'-cyanoimidocarbamate |
| میدان مغناطیسی |
C2H2N3NaO |
| وزن مولکولی |
107.0465 |
| InChI |
InChI=1/C2H3N3O.Na/c3-1-5-2(4)6;/h(H3,4,5,6);/q;+1/p-1 |
| شماره سیایاس |
76989-89-4 |
| تعداد کمیسیون اروپایی |
278-584-3 |
| ساختار مولکولی |
|
| نقطه ذوب |
300℃ |
| نقطه غلیان |
263.3°C at 760 mmHg |
| نقطه اشتعال |
113.1°C |
| خطر نمادها |
 Xn:Harmful;
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|
