ChemNet > CAS > 7745-92-8 2-Iodo-4-nitrotoluene
7745-92-8 2-Iodo-4-nitrotoluene
| نام محصول |
2-Iodo-4-nitrotoluene |
| مترادف |
1-Nitro-3-iodo-4-methylbenzene |
| میدان مغناطیسی |
C7H6INO2 |
| وزن مولکولی |
263.03 |
| InChI |
InChI=1/C7H6INO2/c1-5-2-3-6(9(10)11)4-7(5)8/h2-4H,1H3 |
| شماره سیایاس |
7745-92-8 |
| تعداد کمیسیون اروپایی |
231-808-3 |
| ساختار مولکولی |
|
| نقطه ذوب |
60-62℃ |
| نقطه غلیان |
164-165℃(15 torr) |
| خطر نمادها |
 Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
