ChemNet > CAS > 80333-65-9 3,3',4,4'-tetrachlorobiphenyl-ul-14C
80333-65-9 3,3',4,4'-tetrachlorobiphenyl-ul-14C
نام محصول |
3,3',4,4'-tetrachlorobiphenyl-ul-14C |
مترادف |
1,1'-Biphenyl, 3,3',4,4'-tetrachloro-, labeled with carbon-14; 3,3',4,4'-Tetrachloro(14C-U)biphenyl; 3,3',4,4'-Tetrachloro-1,1'-biphenyl labeled with carbon-14; 3,3',4,4'-tetrachlorobiphenyl |
میدان مغناطیسی |
C12H6Cl4 |
وزن مولکولی |
291.988 |
InChI |
InChI=1/C12H6Cl4/c13-9-3-1-7(5-11(9)15)8-2-4-10(14)12(16)6-8/h1-6H |
شماره سیایاس |
80333-65-9 |
ساختار مولکولی |
|
تراکم |
1.441g/cm3 |
نقطه غلیان |
380.7°C at 760 mmHg |
ضریب شکست |
1.612 |
نقطه اشتعال |
188.4°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
|
|