CAS No: 80450-69-7;2630-39-9;151716-36-8, Chemical Name: Cyclopentaneacetic acid, 3-oxo-2-pentyl-, methyl ester, (1R,2R)-
the physical and chemical property of 80450-69-7;2630-39-9;151716-36-8, Cyclopentaneacetic acid, 3-oxo-2-pentyl-, methyl ester, (1R,2R)- is provided by ChemNet.com
ChemNet > CAS > 80450-69-7;2630-39-9;151716-36-8 Cyclopentaneacetic acid, 3-oxo-2-pentyl-, methyl ester, (1R,2R)-
80450-69-7;2630-39-9;151716-36-8 Cyclopentaneacetic acid, 3-oxo-2-pentyl-, methyl ester, (1R,2R)-
نام محصول |
Cyclopentaneacetic acid, 3-oxo-2-pentyl-, methyl ester, (1R,2R)- |
مترادف |
Methyl trans-dihydrojasmonate; (-)-Methyl dihydrojasmonate; Dihydrojasmonic Acid Methyl Ester; METHYLDIHYDROJASMONATE; methyl [(1R,2R)-3-oxo-2-pentylcyclopentyl]acetate; Methyl 2-(3-Oxo-2-Pentylcyclopentyl)Acetate |
میدان مغناطیسی |
C13H22O3 |
وزن مولکولی |
226.312 |
InChI |
InChI=1/C13H22O3/c1-3-4-5-6-11-10(7-8-12(11)14)9-13(15)16-2/h10-11H,3-9H2,1-2H3/t10-,11-/m1/s1 |
شماره سیایاس |
80450-69-7;2630-39-9;151716-36-8 |
تعداد کمیسیون اروپایی |
220-112-5 |
ساختار مولکولی |
|
تراکم |
0.984g/cm3 |
نقطه غلیان |
307.8°C at 760 mmHg |
ضریب شکست |
1.453 |
نقطه اشتعال |
130.8°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
|
|