ChemNet > CAS > 82-07-5 Xanthene-9-carboxylic acid
82-07-5 Xanthene-9-carboxylic acid
نام محصول |
Xanthene-9-carboxylic acid |
مترادف |
xanthoic acid; Methyl xanthene-9-carboxylate; 9-Xanthene carboxylic acid; Xomthene-9-carboxylic methylester acid; 9H-xanthene-9-carboxylic acid; 9H-xanthene-9-carboxylate |
میدان مغناطیسی |
C14H9O3 |
وزن مولکولی |
225.22 |
InChI |
InChI=1/C14H10O3/c15-14(16)13-9-5-1-3-7-11(9)17-12-8-4-2-6-10(12)13/h1-8,13H,(H,15,16)/p-1 |
شماره سیایاس |
82-07-5 |
تعداد کمیسیون اروپایی |
201-394-9 |
ساختار مولکولی |
|
نقطه ذوب |
221-225℃ |
نقطه غلیان |
391.3°C at 760 mmHg |
نقطه اشتعال |
153.1°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|