ChemNet > CAS > 82-46-2 1,5-Dichloroanthraquinone
82-46-2 1,5-Dichloroanthraquinone
نام محصول |
1,5-Dichloroanthraquinone |
مترادف |
1,5-Dichloranthrachinon; 1,5-Dichloranthrachinon [Czech]; 1,5-Dichloro-9,10-anthraquinone; 9,10-Anthracenedione, 1,5-dichloro-; AI3-38301; NSC 13969; Anthraquinone, 1,5-dichloro-; 1,5-dichloroanthracene-9,10-dione; 1,5-Dichloro Anthraquinone |
میدان مغناطیسی |
C14H6Cl2O2 |
وزن مولکولی |
277.1022 |
InChI |
InChI=1/C14H6Cl2O2/c15-9-5-1-3-7-11(9)14(18)8-4-2-6-10(16)12(8)13(7)17/h1-6H |
شماره سیایاس |
82-46-2 |
تعداد کمیسیون اروپایی |
201-424-0 |
ساختار مولکولی |
|
تراکم |
1.514g/cm3 |
نقطه ذوب |
245-250℃ |
نقطه غلیان |
455.2°C at 760 mmHg |
ضریب شکست |
1.671 |
نقطه اشتعال |
191.7°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|