ChemNet > CAS > 83-18-1 2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde
83-18-1 2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde
نام محصول |
2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde |
مترادف |
1H-Pyrrole-3-carboxaldehyde, 2,5-dimethyl-1-phenyl-; NSC 68230; 2,5-Dimethyl-1-phenyl-1H-pyrrole-3-carbaldehyde; Pyrrole-3-carboxaldehyde, 2,5-dimethyl-1-phenyl- (8CI); 1-cyclohexyl-2,5-dimethyl-1H-pyrrole-3-carbaldehyde; 2,5-dimethyl-1-phenylpyrrole-3-carbaldehyde |
میدان مغناطیسی |
C13H19NO |
وزن مولکولی |
205.2961 |
InChI |
InChI=1/C13H19NO/c1-10-8-12(9-15)11(2)14(10)13-6-4-3-5-7-13/h8-9,13H,3-7H2,1-2H3 |
شماره سیایاس |
83-18-1 |
تعداد کمیسیون اروپایی |
201-458-6 |
ساختار مولکولی |
|
تراکم |
1.07g/cm3 |
نقطه غلیان |
345.8°C at 760 mmHg |
ضریب شکست |
1.559 |
نقطه اشتعال |
163°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|