ChemNet > CAS > 83-24-9 2,5-Dimethyl-1-phenylpyrrole
83-24-9 2,5-Dimethyl-1-phenylpyrrole
نام محصول |
2,5-Dimethyl-1-phenylpyrrole |
مترادف |
1H-Pyrrole, 2,5-dimethyl-1-phenyl-; NSC 163170; 2,5-Dimethyl-1-phenyl-1H-pyrrole; Pyrrole, 2,5-dimethyl-1-phenyl- (8CI); 1-cyclohexyl-2,5-dimethyl-1H-pyrrole; 2,5-dimethyl-1-phenylpyrrolidine |
میدان مغناطیسی |
C12H17N |
وزن مولکولی |
175.2701 |
InChI |
InChI=1/C12H17N/c1-10-8-9-11(2)13(10)12-6-4-3-5-7-12/h3-7,10-11H,8-9H2,1-2H3 |
شماره سیایاس |
83-24-9 |
تعداد کمیسیون اروپایی |
201-461-2 |
ساختار مولکولی |
|
تراکم |
0.952g/cm3 |
نقطه ذوب |
50-51℃ |
نقطه غلیان |
257.7°C at 760 mmHg |
ضریب شکست |
1.519 |
نقطه اشتعال |
100.2°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|