ChemNet > CAS > 89581-82-8 2-Acetyl-3-chlorothiophene
89581-82-8 2-Acetyl-3-chlorothiophene
نام محصول |
2-Acetyl-3-chlorothiophene |
مترادف |
1-(3-chlorothiophen-2-yl)ethanone |
میدان مغناطیسی |
C6H5ClOS |
وزن مولکولی |
160.6213 |
InChI |
InChI=1/C6H5ClOS/c1-4(8)6-5(7)2-3-9-6/h2-3H,1H3 |
شماره سیایاس |
89581-82-8 |
ساختار مولکولی |
|
تراکم |
1.312g/cm3 |
نقطه غلیان |
219.9°C at 760 mmHg |
ضریب شکست |
1.559 |
نقطه اشتعال |
86.8°C |
خطر نمادها |
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|