ChemNet > CAS > 89793-11-3 Methyl-2-chloro-6-methylpyrimidine-4-carboxylate
89793-11-3 Methyl-2-chloro-6-methylpyrimidine-4-carboxylate
نام محصول |
Methyl-2-chloro-6-methylpyrimidine-4-carboxylate |
مترادف |
Methyl 2-chloro-6-methylpyrimidine-4-carboxylate |
میدان مغناطیسی |
C7H7ClN2O2 |
وزن مولکولی |
186.5957 |
InChI |
InChI=1/C7H7ClN2O2/c1-4-3-5(6(11)12-2)10-7(8)9-4/h3H,1-2H3 |
شماره سیایاس |
89793-11-3 |
ساختار مولکولی |
|
تراکم |
1.314g/cm3 |
نقطه ذوب |
107℃ |
نقطه غلیان |
306.5°C at 760 mmHg |
ضریب شکست |
1.53 |
نقطه اشتعال |
139.2°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|