ChemNet > CAS > 92-24-0 2,3-Benzanthracene
92-24-0 2,3-Benzanthracene
نام محصول |
2,3-Benzanthracene |
مترادف |
NAPHTHACENE; Chrysogen; LT-S940; Tetracene |
میدان مغناطیسی |
C18H12 |
وزن مولکولی |
228.2879 |
InChI |
InChI=1/C18H12/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1/h1-12H |
شماره سیایاس |
92-24-0 |
تعداد کمیسیون اروپایی |
202-138-9 |
ساختار مولکولی |
|
تراکم |
1.19g/cm3 |
نقطه ذوب |
300℃ |
نقطه غلیان |
436.7°C at 760 mmHg |
ضریب شکست |
1.771 |
نقطه اشتعال |
209.1°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R40:Possible risks of irreversible effects.;
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|