ChemNet > CAS > 939-83-3 2-Methyl-5-nitrobenzonitrile
939-83-3 2-Methyl-5-nitrobenzonitrile
نام محصول |
2-Methyl-5-nitrobenzonitrile |
مترادف |
5-Nitro-o-tolunitrile |
میدان مغناطیسی |
C8H6N2O2 |
وزن مولکولی |
162.1454 |
InChI |
InChI=1/C8H6N2O2/c1-6-2-3-8(10(11)12)4-7(6)5-9/h2-4H,1H3 |
شماره سیایاس |
939-83-3 |
ساختار مولکولی |
|
تراکم |
1.26g/cm3 |
نقطه ذوب |
103.5-107.5℃ |
نقطه غلیان |
291.5°C at 760 mmHg |
ضریب شکست |
1.568 |
نقطه اشتعال |
130.1°C |
خطر نمادها |
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|