ChemNet > CAS > 944-43-4 4-amino-2,3,5,6-tetrafluorobenzoic acid
944-43-4 4-amino-2,3,5,6-tetrafluorobenzoic acid
نام محصول |
4-amino-2,3,5,6-tetrafluorobenzoic acid |
میدان مغناطیسی |
C7H3F4NO2 |
وزن مولکولی |
209.0978 |
InChI |
InChI=1/C7H3F4NO2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h12H2,(H,13,14) |
شماره سیایاس |
944-43-4 |
تعداد کمیسیون اروپایی |
213-409-6 |
ساختار مولکولی |
|
تراکم |
1.726g/cm3 |
نقطه ذوب |
185-187℃ |
نقطه غلیان |
283.6°C at 760 mmHg |
ضریب شکست |
1.529 |
نقطه اشتعال |
125.3°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|