ChemNet > CAS > 998-29-8 Tri-n-propylsilane
998-29-8 Tri-n-propylsilane
نام محصول |
Tri-n-propylsilane |
مترادف |
Silane, tripropyl-; NSC 96837; Tripropylsilane; tripropylsilyl |
میدان مغناطیسی |
C9H21Si |
وزن مولکولی |
157.3485 |
InChI |
InChI=1/C9H21Si/c1-4-7-10(8-5-2)9-6-3/h4-9H2,1-3H3 |
شماره سیایاس |
998-29-8 |
تعداد کمیسیون اروپایی |
213-649-1 |
ساختار مولکولی |
|
خطر نمادها |
|
کدهای خطر |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|