ChemNet > CAS > 10047-28-6 butyl thioglycolate
10047-28-6 butyl thioglycolate
| Nome del prodotto |
butyl thioglycolate |
| Formula molecolare |
C6H12O2S |
| Peso Molecolare |
148.2233 |
| InChI |
InChI=1/C6H12O2S/c1-2-3-4-9-6(8)5-7/h7H,2-5H2,1H3 |
| Numero CAS |
10047-28-6 |
| EINECS |
233-156-5 |
| Struttura molecolare |
|
| Densità |
1.088g/cm3 |
| Punto di ebollizione |
220.125°C at 760 mmHg |
| Indice di rifrazione |
1.491 |
| Punto d'infiammabilità |
86.929°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
