ChemNet > CAS > 101-17-7 3-Chlorodiphenylamine
101-17-7 3-Chlorodiphenylamine
| Nome del prodotto |
3-Chlorodiphenylamine |
| Sinonimi |
Benzenamine, 3-chloro-N-phenyl-; 3-chloro-N-phenylaniline; 3-Chloro-N-phenyl-benzenamine; N-(3-chlorophenyl)aniline |
| Formula molecolare |
C12H10ClN |
| Peso Molecolare |
203.6675 |
| InChI |
InChI=1/C12H10ClN/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h1-9,14H |
| Numero CAS |
101-17-7 |
| EINECS |
202-922-0 |
| Struttura molecolare |
|
| Densità |
1.216g/cm3 |
| Punto di ebollizione |
337.8°C at 760 mmHg |
| Indice di rifrazione |
1.642 |
| Punto d'infiammabilità |
147.4°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
