ChemNet > CAS > 101-99-5 N-Phenylurethane
101-99-5 N-Phenylurethane
| Nome del prodotto |
N-Phenylurethane |
| Sinonimi |
Ethyl carbanilate~Ethyl N-phenylcarbamate; ethyl phenylcarbamate |
| Formula molecolare |
C9H11NO2 |
| Peso Molecolare |
165.1891 |
| InChI |
InChI=1/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
| Numero CAS |
101-99-5 |
| EINECS |
202-995-9 |
| Struttura molecolare |
|
| Densità |
1.136g/cm3 |
| Punto di ebollizione |
238°C at 760 mmHg |
| Indice di rifrazione |
1.558 |
| Punto d'infiammabilità |
79.2°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R40:Possible risks of irreversible effects.;
|
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
