ChemNet > CAS > 102-38-5 3-Nitroformanilide
102-38-5 3-Nitroformanilide
| Nome del prodotto |
3-Nitroformanilide |
| Sinonimi |
N-(3-nitrophenyl)formamide |
| Formula molecolare |
C7H6N2O3 |
| Peso Molecolare |
166.1341 |
| InChI |
InChI=1/C7H6N2O3/c10-5-8-6-2-1-3-7(4-6)9(11)12/h1-5H,(H,8,10) |
| Numero CAS |
102-38-5 |
| Struttura molecolare |
|
| Densità |
1.407g/cm3 |
| Punto di ebollizione |
368.5°C at 760 mmHg |
| Indice di rifrazione |
1.641 |
| Punto d'infiammabilità |
176.7°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/22:Harmful by inhalation and if swallowed.;
|
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
