ChemNet > CAS > 103956-09-8 3,4-Diaminobenzhydrazide
103956-09-8 3,4-Diaminobenzhydrazide
| Nome del prodotto |
3,4-Diaminobenzhydrazide |
| Sinonimi |
3,4-diaminobenzohydrazide |
| Formula molecolare |
C7H10N4O |
| Peso Molecolare |
166.1805 |
| InChI |
InChI=1/C7H10N4O/c8-5-2-1-4(3-6(5)9)7(12)11-10/h1-3H,8-10H2,(H,11,12) |
| Numero CAS |
103956-09-8 |
| Struttura molecolare |
|
| Densità |
1.367g/cm3 |
| Indice di rifrazione |
1.705 |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
