ChemNet > CAS > 104451-99-2 2-Chloro-6-fluoro-3-methylbenzaldehyde
104451-99-2 2-Chloro-6-fluoro-3-methylbenzaldehyde
| Nome del prodotto |
2-Chloro-6-fluoro-3-methylbenzaldehyde |
| Sinonimi |
2-Chloro-6-fluoro-m-tolualdehyde |
| Formula molecolare |
C8H6ClFO |
| Peso Molecolare |
172.584 |
| InChI |
InChI=1/C8H6ClFO/c1-5-2-3-7(10)6(4-11)8(5)9/h2-4H,1H3 |
| Numero CAS |
104451-99-2 |
| Struttura molecolare |
|
| Densità |
1.292g/cm3 |
| Punto di fusione |
30-33℃ |
| Punto di ebollizione |
225.1°C at 760 mmHg |
| Indice di rifrazione |
1.552 |
| Punto d'infiammabilità |
89.9°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
