ChemNet > CAS > 108485-13-8 4-Bromo-2,3-dimethyl-6-nitroaniline
108485-13-8 4-Bromo-2,3-dimethyl-6-nitroaniline
| Nome del prodotto |
4-Bromo-2,3-dimethyl-6-nitroaniline |
| Sinonimi |
4-Bromo-6-nitro-2,3-xylidine |
| Formula molecolare |
C8H9BrN2O2 |
| Peso Molecolare |
245.0733 |
| InChI |
InChI=1/C8H9BrN2O2/c1-4-5(2)8(10)7(11(12)13)3-6(4)9/h3H,10H2,1-2H3 |
| Numero CAS |
108485-13-8 |
| Struttura molecolare |
|
| Densità |
1.609g/cm3 |
| Punto di ebollizione |
357.9°C at 760 mmHg |
| Indice di rifrazione |
1.632 |
| Punto d'infiammabilità |
170.3°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
