ChemNet > CAS > 109704-53-2 tetramethylammonium triacetoxy borohydride
109704-53-2 tetramethylammonium triacetoxy borohydride
| Nome del prodotto |
tetramethylammonium triacetoxy borohydride |
| Formula molecolare |
C10H22BNO6 |
| Peso Molecolare |
263.0958 |
| InChI |
InChI=1/C6H10BO6.C4H12N/c1-4(8)11-7(12-5(2)9)13-6(3)10;1-5(2,3)4/h7H,1-3H3;1-4H3/q-1;+1 |
| Numero CAS |
109704-53-2 |
| Struttura molecolare |
|
| Punto di fusione |
93-98℃ |
| Simboli di pericolo |
|
| Codici di Rischio |
R15:Contact with water liberates highly flammable gases.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
