ChemNet > CAS > 1124-04-5 2-chloro-4,5-dimethylphenol
1124-04-5 2-chloro-4,5-dimethylphenol
| Nome del prodotto |
2-chloro-4,5-dimethylphenol |
| Sinonimi |
6-Chloro-3,4-xylenol (OH=1); 6-Chloro-3,4-xylenol |
| Formula molecolare |
C8H9ClO |
| Peso Molecolare |
156.6095 |
| InChI |
InChI=1/C8H9ClO/c1-5-3-7(9)8(10)4-6(5)2/h3-4,10H,1-2H3 |
| Numero CAS |
1124-04-5 |
| EINECS |
214-386-5 |
| Struttura molecolare |
|
| Densità |
1.183g/cm3 |
| Punto di fusione |
70-72℃ |
| Punto di ebollizione |
237°C at 760 mmHg |
| Indice di rifrazione |
1.558 |
| Punto d'infiammabilità |
97.1°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
