ChemNet > CAS > 1146-65-2 Naphthalene-d8
1146-65-2 Naphthalene-d8
| Nome del prodotto |
Naphthalene-d8 |
| Formula molecolare |
C10D8 |
| Peso Molecolare |
136.2198 |
| InChI |
InChI=1/C10H8/c1-2-6-10-8-4-3-7-9(10)5-1/h1-8H/i1D,2D,3D,4D,5D,6D,7D,8D |
| Numero CAS |
1146-65-2 |
| EINECS |
214-552-7 |
| Struttura molecolare |
|
| Densità |
1.102g/cm3 |
| Punto di fusione |
81-83℃ |
| Punto di ebollizione |
221.5°C at 760 mmHg |
| Indice di rifrazione |
1.632 |
| Punto d'infiammabilità |
78.9°C |
| Simboli di pericolo |
 Xn:Harmful;
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S36/37:Wear suitable protective clothing and gloves.;
|
|
