ChemNet > CAS > 1171-47-7 2,2-Bis-(4-carboxyphenyl)-hexafluoropropane
1171-47-7 2,2-Bis-(4-carboxyphenyl)-hexafluoropropane
| Nome del prodotto |
2,2-Bis-(4-carboxyphenyl)-hexafluoropropane |
| Formula molecolare |
C7H11FO2 |
| Peso Molecolare |
146.1594 |
| InChI |
InChI=1/C7H11FO2/c8-7(6(9)10)4-2-1-3-5-7/h1-5H2,(H,9,10) |
| Numero CAS |
1171-47-7 |
| Struttura molecolare |
|
| Densità |
1.159g/cm3 |
| Punto di ebollizione |
227.566°C at 760 mmHg |
| Indice di rifrazione |
1.454 |
| Punto d'infiammabilità |
91.429°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
