ChemNet > CAS > 1197-19-9 4-(Dimethylamino)benzonitrile
1197-19-9 4-(Dimethylamino)benzonitrile
| Nome del prodotto |
4-(Dimethylamino)benzonitrile |
| Sinonimi |
4-Dimethylaminobenzonitrile; 4-Cyano-NN-dimethylaniline |
| Formula molecolare |
C9H10N2 |
| Peso Molecolare |
146.1891 |
| InChI |
InChI=1/C9H10N2/c1-11(2)9-5-3-8(7-10)4-6-9/h3-6H,1-2H3 |
| Numero CAS |
1197-19-9 |
| EINECS |
214-819-8 |
| Struttura molecolare |
|
| Densità |
1.04g/cm3 |
| Punto di fusione |
70-76℃ |
| Punto di ebollizione |
318.8°C at 760 mmHg |
| Indice di rifrazione |
1.55 |
| Punto d'infiammabilità |
145.4°C |
| Simboli di pericolo |
 Xn:Harmful;
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S36/37:Wear suitable protective clothing and gloves.;
|
|
