ChemNet > CAS > 120355-50-2 2,6-Dichloro-beta-nitrostyrene
120355-50-2 2,6-Dichloro-beta-nitrostyrene
| Nome del prodotto |
2,6-Dichloro-beta-nitrostyrene |
| Sinonimi |
1-(2,6-Dichlorophenyl)-2-nitroethene; 1,3-dichloro-2-[(E)-2-nitroethenyl]benzene |
| Formula molecolare |
C8H5Cl2NO2 |
| Peso Molecolare |
218.0368 |
| InChI |
InChI=1/C8H5Cl2NO2/c9-7-2-1-3-8(10)6(7)4-5-11(12)13/h1-5H/b5-4+ |
| Numero CAS |
120355-50-2 |
| Struttura molecolare |
|
| Densità |
1.447g/cm3 |
| Punto di ebollizione |
330.6°C at 760 mmHg |
| Indice di rifrazione |
1.626 |
| Punto d'infiammabilità |
153.7°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
