ChemNet > CAS > 123333-92-6;56737-75-8 2,3-Dimethylphenylhydrazine hydrochloride
123333-92-6;56737-75-8 2,3-Dimethylphenylhydrazine hydrochloride
| Nome del prodotto |
2,3-Dimethylphenylhydrazine hydrochloride |
| Sinonimi |
(2,3-dimethylphenyl)diazanium chloride; (2,3-dimethylphenyl)hydrazine; (2,3-dimethylphenyl)hydrazine hydrochloride hydrate |
| Formula molecolare |
C8H15ClN2O |
| Peso Molecolare |
190.6705 |
| InChI |
InChI=1/C8H12N2.ClH.H2O/c1-6-4-3-5-8(10-9)7(6)2;;/h3-5,10H,9H2,1-2H3;1H;1H2 |
| Numero CAS |
123333-92-6;56737-75-8 |
| Struttura molecolare |
|
| Punto di fusione |
210℃ |
| Punto di ebollizione |
355°C at 760 mmHg |
| Punto d'infiammabilità |
168.5°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
