ChemNet > CAS > 124276-67-1 1-(4-bromophenyl)cyclopropanecarbonitrile
124276-67-1 1-(4-bromophenyl)cyclopropanecarbonitrile
| Nome del prodotto |
1-(4-bromophenyl)cyclopropanecarbonitrile |
| Sinonimi |
4-(4-bromophenyl)-2-methylpyrimidine; 1-(4-Bromophenyl)-cyclopropane carbonitrile; 1-(4-broMophenyl)cyclopropane-1-carbonitrile |
| Formula molecolare |
C11H9BrN2 |
| Peso Molecolare |
249.1066 |
| InChI |
InChI=1/C11H9BrN2/c1-8-13-7-6-11(14-8)9-2-4-10(12)5-3-9/h2-7H,1H3 |
| Numero CAS |
124276-67-1 |
| Struttura molecolare |
|
| Densità |
1.434g/cm3 |
| Punto di fusione |
84℃ |
| Punto di ebollizione |
341.4°C at 760 mmHg |
| Indice di rifrazione |
1.601 |
| Punto d'infiammabilità |
160.3°C |
| Simboli di pericolo |
 Xn:Harmful;
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
