ChemNet > CAS > 13194-68-8 4-iodo-2-methylaniline
13194-68-8 4-iodo-2-methylaniline
| Nome del prodotto |
4-iodo-2-methylaniline |
| Sinonimi |
2-Amino-5-iodotoluene; 4-Iodo-o-toluidine; 4-Iodo-o-toluidine (NH2=1) |
| Formula molecolare |
C7H8IN |
| Peso Molecolare |
233.0496 |
| InChI |
InChI=1/C7H8IN/c1-5-4-6(8)2-3-7(5)9/h2-4H,9H2,1H3 |
| Numero CAS |
13194-68-8 |
| EINECS |
236-154-2 |
| Struttura molecolare |
|
| Densità |
1.791g/cm3 |
| Punto di fusione |
86-89℃ |
| Punto di ebollizione |
278.4°C at 760 mmHg |
| Indice di rifrazione |
1.663 |
| Punto d'infiammabilità |
122.1°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
