ChemNet > CAS > 132-86-5 1,3-Dihydroxynaphthalene
132-86-5 1,3-Dihydroxynaphthalene
| Nome del prodotto |
1,3-Dihydroxynaphthalene |
| Sinonimi |
1,3-Naphthalenediol; Naphthoresorcinol; naphtharesorcinol; NAPHTORESORCINE; naphthalene-1,3-diol |
| Formula molecolare |
C10H8O2 |
| Peso Molecolare |
160.1693 |
| InChI |
InChI=1/C10H8O2/c11-8-5-7-3-1-2-4-9(7)10(12)6-8/h1-6,11-12H |
| Numero CAS |
132-86-5 |
| EINECS |
205-079-7 |
| Struttura molecolare |
|
| Densità |
1.33g/cm3 |
| Punto di fusione |
123-126℃ |
| Punto di ebollizione |
361.5°C at 760 mmHg |
| Indice di rifrazione |
1.725 |
| Punto d'infiammabilità |
185.5°C |
| Simboli di pericolo |
 Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
