ChemNet > CAS > 13294-71-8 2-Bromo-2-butene, mixture of cis and trans
13294-71-8 2-Bromo-2-butene, mixture of cis and trans
| Nome del prodotto |
2-Bromo-2-butene, mixture of cis and trans |
| Sinonimi |
2-Bromo-2-butene (cis+trans); Bromobutenecistrans; 2-Bromo-2-butene; 2-bromobut-2-ene; (2Z)-2-bromobut-2-ene; (2E)-2-bromobut-2-ene |
| Formula molecolare |
C4H7Br |
| Peso Molecolare |
135.0024 |
| InChI |
InChI=1/C4H7Br/c1-3-4(2)5/h3H,1-2H3/b4-3+ |
| Numero CAS |
13294-71-8 |
| EINECS |
236-316-2 |
| Struttura molecolare |
|
| Densità |
1.334g/cm3 |
| Punto di ebollizione |
93.9°C at 760 mmHg |
| Indice di rifrazione |
1.469 |
| Punto d'infiammabilità |
13.6°C |
| Simboli di pericolo |
 F:Highly flammable;
|
| Codici di Rischio |
R11:Highly flammable.;
|
| Sicurezza Descrizione |
S16:Keep away from sources of ignition - No smoking.;
|
|
