ChemNet > CAS > 135-01-3 1,2-diethylbenzene
135-01-3 1,2-diethylbenzene
| Nome del prodotto |
1,2-diethylbenzene |
| Sinonimi |
Diethylbenzene; o-Diethylbenzene |
| Formula molecolare |
C10H14 |
| Peso Molecolare |
134.2182 |
| InChI |
InChI=1/C10H14/c1-3-9-7-5-6-8-10(9)4-2/h5-8H,3-4H2,1-2H3 |
| Numero CAS |
135-01-3 |
| EINECS |
205-170-1 |
| Struttura molecolare |
|
| Densità |
0.865g/cm3 |
| Punto di ebollizione |
183.5°C at 760 mmHg |
| Indice di rifrazione |
1.496 |
| Punto d'infiammabilità |
49.4°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
