ChemNet > CAS > 13631-21-5 4-Bromo-3-chlorophenol
13631-21-5 4-Bromo-3-chlorophenol
| Nome del prodotto |
4-Bromo-3-chlorophenol |
| Formula molecolare |
C6H4BrClO |
| Peso Molecolare |
207.4524 |
| InChI |
InChI=1/C6H4BrClO/c7-5-2-1-4(9)3-6(5)8/h1-3,9H |
| Numero CAS |
13631-21-5 |
| Struttura molecolare |
|
| Densità |
1.788g/cm3 |
| Punto di ebollizione |
267.5°C at 760 mmHg |
| Indice di rifrazione |
1.619 |
| Punto d'infiammabilità |
115.6°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
