ChemNet > CAS > 1548-74-9 4-amino-2,3,5,6-tetrafluorobenzamide
1548-74-9 4-amino-2,3,5,6-tetrafluorobenzamide
| Nome del prodotto |
4-amino-2,3,5,6-tetrafluorobenzamide |
| Formula molecolare |
C7H4F4N2O |
| Peso Molecolare |
208.1131 |
| InChI |
InChI=1/C7H4F4N2O/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h12H2,(H2,13,14) |
| Numero CAS |
1548-74-9 |
| EINECS |
216-285-1 |
| Struttura molecolare |
|
| Densità |
1.635g/cm3 |
| Punto di fusione |
185-186℃ |
| Punto di ebollizione |
148.4°C at 760 mmHg |
| Indice di rifrazione |
1.531 |
| Punto d'infiammabilità |
43.5°C |
| Simboli di pericolo |
 Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
