ChemNet > CAS > 1569-60-4 6-methyl-5-hepten-2-ol
1569-60-4 6-methyl-5-hepten-2-ol
| Nome del prodotto |
6-methyl-5-hepten-2-ol |
| Sinonimi |
(+/-)-6-Methyl-5-hepten-2-ol; 6-methylhept-5-en-2-ol; (2R)-6-methylhept-5-en-2-ol |
| Formula molecolare |
C8H16O |
| Peso Molecolare |
128.212 |
| InChI |
InChI=1/C8H16O/c1-7(2)5-4-6-8(3)9/h5,8-9H,4,6H2,1-3H3/t8-/m1/s1 |
| Numero CAS |
1569-60-4 |
| EINECS |
216-377-1 |
| Struttura molecolare |
|
| Densità |
0.844g/cm3 |
| Punto di ebollizione |
175°C at 760 mmHg |
| Indice di rifrazione |
1.446 |
| Punto d'infiammabilità |
67.8°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|
