ChemNet > CAS > 16689-02-4 5-Nitrothiophene-2-carbonitrile
16689-02-4 5-Nitrothiophene-2-carbonitrile
| Nome del prodotto |
5-Nitrothiophene-2-carbonitrile |
| Sinonimi |
2-Cyano-5-nitrothiophene |
| Formula molecolare |
C5H2N2O2S |
| Peso Molecolare |
154.1466 |
| InChI |
InChI=1/C5H2N2O2S/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
| Numero CAS |
16689-02-4 |
| Struttura molecolare |
|
| Densità |
1.5g/cm3 |
| Punto di ebollizione |
273.9°C at 760 mmHg |
| Indice di rifrazione |
1.611 |
| Punto d'infiammabilità |
119.4°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
